C12H10F2N2S — CID 116965323
2-(azetidin-3-yl)-4-(2,4-difluorophenyl)-1,3-thiazole (PubChem CID 116965323) has the molecular formula C12H10F2N2S and a molecular weight of 252.29 g/mol. Its IUPAC name is 2-(azetidin-3-yl)-4-(2,4-difluorophenyl)-1,3-thiazole.
| Compound Name | 2-(azetidin-3-yl)-4-(2,4-difluorophenyl)-1,3-thiazole |
|---|---|
| PubChem CID | 116965323 |
| Molecular Formula | C12H10F2N2S |
| Molecular Weight | 252.29 g/mol |
| Exact Mass | 252.05 |
| IUPAC Name | 2-(azetidin-3-yl)-4-(2,4-difluorophenyl)-1,3-thiazole |
| SMILES | Fc1ccc(-c2csc(C3CNC3)n2)c(F)c1 |
| InChI | InChI=1S/C12H10F2N2S/c13-8-1-2-9(10(14)3-8)11-6-17-12(16-11)7-4-15-5-7/h1-3,6-7,15H,4-5H2 |
| InChIKey | OKFWACJDKGCIGV-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.29 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |