C17H16F2N4O3S3 — CID 156761954
[(2S)-2-(2-cyclopropyl-1,3-thiazol-4-yl)-2-[[4-(2,4-difluorophenyl)-1,3-thiazol-2-yl]amino]ethyl]sulfamic acid (PubChem CID 156761954) has the molecular formula C17H16F2N4O3S3 and a molecular weight of 458.54 g/mol. Its IUPAC name is [(2S)-2-(2-cyclopropyl-1,3-thiazol-4-yl)-2-[[4-(2,4-difluorophenyl)-1,3-thiazol-2-yl]amino]ethyl]sulfamic acid.
| Compound Name | [(2S)-2-(2-cyclopropyl-1,3-thiazol-4-yl)-2-[[4-(2,4-difluorophenyl)-1,3-thiazol-2-yl]amino]ethyl]sulfamic acid |
|---|---|
| PubChem CID | 156761954 |
| Molecular Formula | C17H16F2N4O3S3 |
| Molecular Weight | 458.54 g/mol |
| Exact Mass | 458.04 |
| IUPAC Name | [(2S)-2-(2-cyclopropyl-1,3-thiazol-4-yl)-2-[[4-(2,4-difluorophenyl)-1,3-thiazol-2-yl]amino]ethyl]sulfamic acid |
| SMILES | O=S(=O)(O)NC[C@H](Nc1nc(-c2ccc(F)cc2F)cs1)c1csc(C2CC2)n1 |
| InChI | InChI=1S/C17H16F2N4O3S3/c18-10-3-4-11(12(19)5-10)14-7-28-17(23-14)22-13(6-20-29(24,25)26)15-8-27-16(21-15)9-1-2-9/h3-5,7-9,13,20H,1-2,6H2,(H,22,23)(H,24,25,26)/t13-/m0/s1 |
| InChIKey | IRMIGCXOBLCPEN-ZDUSSCGKSA-N |
| XLogP | 3.97 |
| TPSA | 104.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.54 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|