C15H15F2N3S — CID 90656446
4-(2,4-difluorophenyl)-N-[(E)-[(3R)-3-methylcyclopentylidene]amino]-1,3-thiazol-2-amine (PubChem CID 90656446) has the molecular formula C15H15F2N3S and a molecular weight of 307.37 g/mol. Its IUPAC name is 4-(2,4-difluorophenyl)-N-[(E)-[(3R)-3-methylcyclopentylidene]amino]-1,3-thiazol-2-amine.
| Compound Name | 4-(2,4-difluorophenyl)-N-[(E)-[(3R)-3-methylcyclopentylidene]amino]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 90656446 |
| Molecular Formula | C15H15F2N3S |
| Molecular Weight | 307.37 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | 4-(2,4-difluorophenyl)-N-[(E)-[(3R)-3-methylcyclopentylidene]amino]-1,3-thiazol-2-amine |
| SMILES | C[C@@H]1CC/C(=N\Nc2nc(-c3ccc(F)cc3F)cs2)C1 |
| InChI | InChI=1S/C15H15F2N3S/c1-9-2-4-11(6-9)19-20-15-18-14(8-21-15)12-5-3-10(16)7-13(12)17/h3,5,7-9H,2,4,6H2,1H3,(H,18,20)/b19-11+/t9-/m1/s1 |
| InChIKey | PJWFRUUGFPZZBB-KRLZGKIESA-N |
| XLogP | 4.68 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.37 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|