C16H16N4S — CID 90676871
4-[2-[(2Z)-2-(3-methylcyclopentylidene)hydrazinyl]-1,3-thiazol-4-yl]benzonitrile (PubChem CID 90676871) has the molecular formula C16H16N4S and a molecular weight of 296.40 g/mol. Its IUPAC name is 4-[2-[(2Z)-2-(3-methylcyclopentylidene)hydrazinyl]-1,3-thiazol-4-yl]benzonitrile.
| Compound Name | 4-[2-[(2Z)-2-(3-methylcyclopentylidene)hydrazinyl]-1,3-thiazol-4-yl]benzonitrile |
|---|---|
| PubChem CID | 90676871 |
| Molecular Formula | C16H16N4S |
| Molecular Weight | 296.40 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | 4-[2-[(2Z)-2-(3-methylcyclopentylidene)hydrazinyl]-1,3-thiazol-4-yl]benzonitrile |
| SMILES | CC1CC/C(=N/Nc2nc(-c3ccc(C#N)cc3)cs2)C1 |
| InChI | InChI=1S/C16H16N4S/c1-11-2-7-14(8-11)19-20-16-18-15(10-21-16)13-5-3-12(9-17)4-6-13/h3-6,10-11H,2,7-8H2,1H3,(H,18,20)/b19-14- |
| InChIKey | CWXSKBDUPSQAGF-RGEXLXHISA-N |
| XLogP | 4.27 |
| TPSA | 61.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.40 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|