C17H19ClN4S — CID 155524455
4-(4-chlorophenyl)-N-[[(1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-ylidene]amino]-1,3-thiazol-2-amine (PubChem CID 155524455) has the molecular formula C17H19ClN4S and a molecular weight of 346.89 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-N-[[(1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-ylidene]amino]-1,3-thiazol-2-amine.
| Compound Name | 4-(4-chlorophenyl)-N-[[(1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-ylidene]amino]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 155524455 |
| Molecular Formula | C17H19ClN4S |
| Molecular Weight | 346.89 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | 4-(4-chlorophenyl)-N-[[(1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-ylidene]amino]-1,3-thiazol-2-amine |
| SMILES | CN1[C@@H]2CC[C@H]1C/C(=N/Nc1nc(-c3ccc(Cl)cc3)cs1)C2 |
| InChI | InChI=1S/C17H19ClN4S/c1-22-14-6-7-15(22)9-13(8-14)20-21-17-19-16(10-23-17)11-2-4-12(18)5-3-11/h2-5,10,14-15H,6-9H2,1H3,(H,19,21)/b20-13-/t14-,15+/m0/s1 |
| InChIKey | KJOYJUNXUHXZBF-DYDKSKQESA-N |
| XLogP | 4.49 |
| TPSA | 40.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.89 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|