C16H14N4S — CID 123742783
4-[2-(2-cyclohex-2-en-1-ylidenehydrazinyl)-1,3-thiazol-4-yl]benzonitrile (PubChem CID 123742783) has the molecular formula C16H14N4S and a molecular weight of 294.38 g/mol. Its IUPAC name is 4-[2-(2-cyclohex-2-en-1-ylidenehydrazinyl)-1,3-thiazol-4-yl]benzonitrile.
| Compound Name | 4-[2-(2-cyclohex-2-en-1-ylidenehydrazinyl)-1,3-thiazol-4-yl]benzonitrile |
|---|---|
| PubChem CID | 123742783 |
| Molecular Formula | C16H14N4S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | 4-[2-(2-cyclohex-2-en-1-ylidenehydrazinyl)-1,3-thiazol-4-yl]benzonitrile |
| SMILES | N#Cc1ccc(-c2csc(NN=C3C=CCCC3)n2)cc1 |
| InChI | InChI=1S/C16H14N4S/c17-10-12-6-8-13(9-7-12)15-11-21-16(18-15)20-19-14-4-2-1-3-5-14/h2,4,6-9,11H,1,3,5H2,(H,18,20) |
| InChIKey | UBNJNHSROGVKFT-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 61.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|