C15H12N6S — CID 169490567
4-[2-[2-[(1-methylimidazol-2-yl)methylidene]hydrazinyl]-1,3-thiazol-4-yl]benzonitrile (PubChem CID 169490567) has the molecular formula C15H12N6S and a molecular weight of 308.37 g/mol. Its IUPAC name is 4-[2-[2-[(1-methylimidazol-2-yl)methylidene]hydrazinyl]-1,3-thiazol-4-yl]benzonitrile.
| Compound Name | 4-[2-[2-[(1-methylimidazol-2-yl)methylidene]hydrazinyl]-1,3-thiazol-4-yl]benzonitrile |
|---|---|
| PubChem CID | 169490567 |
| Molecular Formula | C15H12N6S |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | 4-[2-[2-[(1-methylimidazol-2-yl)methylidene]hydrazinyl]-1,3-thiazol-4-yl]benzonitrile |
| SMILES | Cn1ccnc1C=NNc1nc(-c2ccc(C#N)cc2)cs1 |
| InChI | InChI=1S/C15H12N6S/c1-21-7-6-17-14(21)9-18-20-15-19-13(10-22-15)12-4-2-11(8-16)3-5-12/h2-7,9-10H,1H3,(H,19,20) |
| InChIKey | CUGIJLMROZDJFT-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 78.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|