C24H23N4O2S3- — CID 138465342
2-[[(1S)-1-(2-cyclopropyl-1,3-thiazol-4-yl)-2-[4-(sulfinatoamino)phenyl]ethyl]amino]-4-(2-methylphenyl)-1,3-thiazole (PubChem CID 138465342) has the molecular formula C24H23N4O2S3- and a molecular weight of 495.68 g/mol. Its IUPAC name is 2-[[(1S)-1-(2-cyclopropyl-1,3-thiazol-4-yl)-2-[4-(sulfinatoamino)phenyl]ethyl]amino]-4-(2-methylphenyl)-1,3-thiazole.
| Compound Name | 2-[[(1S)-1-(2-cyclopropyl-1,3-thiazol-4-yl)-2-[4-(sulfinatoamino)phenyl]ethyl]amino]-4-(2-methylphenyl)-1,3-thiazole |
|---|---|
| PubChem CID | 138465342 |
| Molecular Formula | C24H23N4O2S3- |
| Molecular Weight | 495.68 g/mol |
| Exact Mass | 495.10 |
| IUPAC Name | 2-[[(1S)-1-(2-cyclopropyl-1,3-thiazol-4-yl)-2-[4-(sulfinatoamino)phenyl]ethyl]amino]-4-(2-methylphenyl)-1,3-thiazole |
| SMILES | Cc1ccccc1-c1csc(N[C@@H](Cc2ccc(NS(=O)[O-])cc2)c2csc(C3CC3)n2)n1 |
| InChI | InChI=1S/C24H24N4O2S3/c1-15-4-2-3-5-19(15)21-13-32-24(27-21)26-20(22-14-31-23(25-22)17-8-9-17)12-16-6-10-18(11-7-16)28-33(29)30/h2-7,10-11,13-14,17,20,28H,8-9,12H2,1H3,(H,26,27)(H,29,30)/p-1/t20-/m0/s1 |
| InChIKey | UXFYXYQXJUNDIH-FQEVSTJZSA-M |
| XLogP | 6.05 |
| TPSA | 89.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.68 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|