C20H22N3O4S3- — CID 134426511
4-[(1S)-1-(benzylsulfonylamino)-2-[4-(sulfinatoamino)phenyl]ethyl]-2-ethyl-1,3-thiazole (PubChem CID 134426511) has the molecular formula C20H22N3O4S3- and a molecular weight of 464.61 g/mol. Its IUPAC name is 4-[(1S)-1-(benzylsulfonylamino)-2-[4-(sulfinatoamino)phenyl]ethyl]-2-ethyl-1,3-thiazole.
| Compound Name | 4-[(1S)-1-(benzylsulfonylamino)-2-[4-(sulfinatoamino)phenyl]ethyl]-2-ethyl-1,3-thiazole |
|---|---|
| PubChem CID | 134426511 |
| Molecular Formula | C20H22N3O4S3- |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.08 |
| IUPAC Name | 4-[(1S)-1-(benzylsulfonylamino)-2-[4-(sulfinatoamino)phenyl]ethyl]-2-ethyl-1,3-thiazole |
| SMILES | CCc1nc([C@H](Cc2ccc(NS(=O)[O-])cc2)NS(=O)(=O)Cc2ccccc2)cs1 |
| InChI | InChI=1S/C20H23N3O4S3/c1-2-20-21-19(13-28-20)18(12-15-8-10-17(11-9-15)22-29(24)25)23-30(26,27)14-16-6-4-3-5-7-16/h3-11,13,18,22-23H,2,12,14H2,1H3,(H,24,25)/p-1/t18-/m0/s1 |
| InChIKey | WNPYRRUKEABIAV-SFHVURJKSA-M |
| XLogP | 3.31 |
| TPSA | 111.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|