C28H27N4O5S2- — CID 134173739
4-[(1S)-1-[[(2S)-2-(methoxycarbonylamino)-3-phenylpropanoyl]amino]-2-[4-(sulfinatoamino)phenyl]ethyl]-2-phenyl-1,3-thiazole (PubChem CID 134173739) has the molecular formula C28H27N4O5S2- and a molecular weight of 563.68 g/mol. Its IUPAC name is 4-[(1S)-1-[[(2S)-2-(methoxycarbonylamino)-3-phenylpropanoyl]amino]-2-[4-(sulfinatoamino)phenyl]ethyl]-2-phenyl-1,3-thiazole.
| Compound Name | 4-[(1S)-1-[[(2S)-2-(methoxycarbonylamino)-3-phenylpropanoyl]amino]-2-[4-(sulfinatoamino)phenyl]ethyl]-2-phenyl-1,3-thiazole |
|---|---|
| PubChem CID | 134173739 |
| Molecular Formula | C28H27N4O5S2- |
| Molecular Weight | 563.68 g/mol |
| Exact Mass | 563.14 |
| IUPAC Name | 4-[(1S)-1-[[(2S)-2-(methoxycarbonylamino)-3-phenylpropanoyl]amino]-2-[4-(sulfinatoamino)phenyl]ethyl]-2-phenyl-1,3-thiazole |
| SMILES | COC(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccc(NS(=O)[O-])cc1)c1csc(-c2ccccc2)n1 |
| InChI | InChI=1S/C28H28N4O5S2/c1-37-28(34)31-24(17-19-8-4-2-5-9-19)26(33)29-23(16-20-12-14-22(15-13-20)32-39(35)36)25-18-38-27(30-25)21-10-6-3-7-11-21/h2-15,18,23-24,32H,16-17H2,1H3,(H,29,33)(H,31,34)(H,35,36)/p-1/t23-,24-/m0/s1 |
| InChIKey | LBYYMYMLHORBOW-ZEQRLZLVSA-M |
| XLogP | 4.38 |
| TPSA | 132.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.68 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|