C27H28N4O7S3 — CID 138458078
methyl N-[(2S)-1-[[(1S)-2-[4-(methylperoxysulfonylamino)phenyl]-1-(2-thiophen-2-yl-1,3-thiazol-4-yl)ethyl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate (PubChem CID 138458078) has the molecular formula C27H28N4O7S3 and a molecular weight of 616.74 g/mol. Its IUPAC name is methyl N-[(2S)-1-[[(1S)-2-[4-(methylperoxysulfonylamino)phenyl]-1-(2-thiophen-2-yl-1,3-thiazol-4-yl)ethyl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate.
| Compound Name | methyl N-[(2S)-1-[[(1S)-2-[4-(methylperoxysulfonylamino)phenyl]-1-(2-thiophen-2-yl-1,3-thiazol-4-yl)ethyl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 138458078 |
| Molecular Formula | C27H28N4O7S3 |
| Molecular Weight | 616.74 g/mol |
| Exact Mass | 616.11 |
| IUPAC Name | methyl N-[(2S)-1-[[(1S)-2-[4-(methylperoxysulfonylamino)phenyl]-1-(2-thiophen-2-yl-1,3-thiazol-4-yl)ethyl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate |
| SMILES | COOS(=O)(=O)Nc1ccc(C[C@H](NC(=O)[C@H](Cc2ccccc2)NC(=O)OC)c2csc(-c3cccs3)n2)cc1 |
| InChI | InChI=1S/C27H28N4O7S3/c1-36-27(33)30-22(16-18-7-4-3-5-8-18)25(32)28-21(23-17-40-26(29-23)24-9-6-14-39-24)15-19-10-12-20(13-11-19)31-41(34,35)38-37-2/h3-14,17,21-22,31H,15-16H2,1-2H3,(H,28,32)(H,30,33)/t21-,22-/m0/s1 |
| InChIKey | OTBGDYJPHQBTAM-VXKWHMMOSA-N |
| XLogP | 4.47 |
| TPSA | 144.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.74 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|