C28H28N4O6S2 — CID 57497740
[4-[2-[[2-(methoxycarbonylamino)-3-phenylpropanoyl]amino]-2-(2-phenyl-1,3-thiazol-4-yl)ethyl]phenyl]sulfamic acid (PubChem CID 57497740) has the molecular formula C28H28N4O6S2 and a molecular weight of 580.69 g/mol. Its IUPAC name is [4-[2-[[2-(methoxycarbonylamino)-3-phenylpropanoyl]amino]-2-(2-phenyl-1,3-thiazol-4-yl)ethyl]phenyl]sulfamic acid.
| Compound Name | [4-[2-[[2-(methoxycarbonylamino)-3-phenylpropanoyl]amino]-2-(2-phenyl-1,3-thiazol-4-yl)ethyl]phenyl]sulfamic acid |
|---|---|
| PubChem CID | 57497740 |
| Molecular Formula | C28H28N4O6S2 |
| Molecular Weight | 580.69 g/mol |
| Exact Mass | 580.15 |
| IUPAC Name | [4-[2-[[2-(methoxycarbonylamino)-3-phenylpropanoyl]amino]-2-(2-phenyl-1,3-thiazol-4-yl)ethyl]phenyl]sulfamic acid |
| SMILES | COC(=O)NC(Cc1ccccc1)C(=O)NC(Cc1ccc(NS(=O)(=O)O)cc1)c1csc(-c2ccccc2)n1 |
| InChI | InChI=1S/C28H28N4O6S2/c1-38-28(34)31-24(17-19-8-4-2-5-9-19)26(33)29-23(16-20-12-14-22(15-13-20)32-40(35,36)37)25-18-39-27(30-25)21-10-6-3-7-11-21/h2-15,18,23-24,32H,16-17H2,1H3,(H,29,33)(H,31,34)(H,35,36,37) |
| InChIKey | ADHAMZCDBCHQLA-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 146.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.69 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|