C16H20N4O6S3 — CID 91527122
[4-[2-[[2-(methoxycarbonylamino)-2-sulfanylacetyl]amino]-2-(2-methyl-1,3-thiazol-4-yl)ethyl]phenyl]sulfamic acid (PubChem CID 91527122) has the molecular formula C16H20N4O6S3 and a molecular weight of 460.56 g/mol. Its IUPAC name is [4-[2-[[2-(methoxycarbonylamino)-2-sulfanylacetyl]amino]-2-(2-methyl-1,3-thiazol-4-yl)ethyl]phenyl]sulfamic acid.
| Compound Name | [4-[2-[[2-(methoxycarbonylamino)-2-sulfanylacetyl]amino]-2-(2-methyl-1,3-thiazol-4-yl)ethyl]phenyl]sulfamic acid |
|---|---|
| PubChem CID | 91527122 |
| Molecular Formula | C16H20N4O6S3 |
| Molecular Weight | 460.56 g/mol |
| Exact Mass | 460.05 |
| IUPAC Name | [4-[2-[[2-(methoxycarbonylamino)-2-sulfanylacetyl]amino]-2-(2-methyl-1,3-thiazol-4-yl)ethyl]phenyl]sulfamic acid |
| SMILES | COC(=O)NC(S)C(=O)NC(Cc1ccc(NS(=O)(=O)O)cc1)c1csc(C)n1 |
| InChI | InChI=1S/C16H20N4O6S3/c1-9-17-13(8-28-9)12(18-14(21)15(27)19-16(22)26-2)7-10-3-5-11(6-4-10)20-29(23,24)25/h3-6,8,12,15,20,27H,7H2,1-2H3,(H,18,21)(H,19,22)(H,23,24,25) |
| InChIKey | OHGQDOSQUUMKIJ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 146.72 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.56 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|