C24H27N3O6S2 — CID 66695017
[4-[2-[(2-benzyl-3-methoxy-3-oxopropanoyl)amino]-2-(2-ethyl-1,3-thiazol-4-yl)ethyl]phenyl]sulfamic acid (PubChem CID 66695017) has the molecular formula C24H27N3O6S2 and a molecular weight of 517.63 g/mol. Its IUPAC name is [4-[2-[(2-benzyl-3-methoxy-3-oxopropanoyl)amino]-2-(2-ethyl-1,3-thiazol-4-yl)ethyl]phenyl]sulfamic acid.
| Compound Name | [4-[2-[(2-benzyl-3-methoxy-3-oxopropanoyl)amino]-2-(2-ethyl-1,3-thiazol-4-yl)ethyl]phenyl]sulfamic acid |
|---|---|
| PubChem CID | 66695017 |
| Molecular Formula | C24H27N3O6S2 |
| Molecular Weight | 517.63 g/mol |
| Exact Mass | 517.13 |
| IUPAC Name | [4-[2-[(2-benzyl-3-methoxy-3-oxopropanoyl)amino]-2-(2-ethyl-1,3-thiazol-4-yl)ethyl]phenyl]sulfamic acid |
| SMILES | CCc1nc(C(Cc2ccc(NS(=O)(=O)O)cc2)NC(=O)C(Cc2ccccc2)C(=O)OC)cs1 |
| InChI | InChI=1S/C24H27N3O6S2/c1-3-22-25-21(15-34-22)20(14-17-9-11-18(12-10-17)27-35(30,31)32)26-23(28)19(24(29)33-2)13-16-7-5-4-6-8-16/h4-12,15,19-20,27H,3,13-14H2,1-2H3,(H,26,28)(H,30,31,32) |
| InChIKey | XCKNFVPGODINKZ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 134.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.63 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|