C25H27N3O6S2 — CID 24815591
[4-[(2S)-2-[[(2S)-2-benzyl-3-methoxy-3-oxopropanoyl]amino]-2-(5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-yl)ethyl]phenyl]sulfamic acid (PubChem CID 24815591) has the molecular formula C25H27N3O6S2 and a molecular weight of 529.64 g/mol. Its IUPAC name is [4-[(2S)-2-[[(2S)-2-benzyl-3-methoxy-3-oxopropanoyl]amino]-2-(5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-yl)ethyl]phenyl]sulfamic acid.
| Compound Name | [4-[(2S)-2-[[(2S)-2-benzyl-3-methoxy-3-oxopropanoyl]amino]-2-(5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-yl)ethyl]phenyl]sulfamic acid |
|---|---|
| PubChem CID | 24815591 |
| Molecular Formula | C25H27N3O6S2 |
| Molecular Weight | 529.64 g/mol |
| Exact Mass | 529.13 |
| IUPAC Name | [4-[(2S)-2-[[(2S)-2-benzyl-3-methoxy-3-oxopropanoyl]amino]-2-(5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-yl)ethyl]phenyl]sulfamic acid |
| SMILES | COC(=O)[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccc(NS(=O)(=O)O)cc1)c1nc2c(s1)CCC2 |
| InChI | InChI=1S/C25H27N3O6S2/c1-34-25(30)19(14-16-6-3-2-4-7-16)23(29)26-21(24-27-20-8-5-9-22(20)35-24)15-17-10-12-18(13-11-17)28-36(31,32)33/h2-4,6-7,10-13,19,21,28H,5,8-9,14-15H2,1H3,(H,26,29)(H,31,32,33)/t19-,21-/m0/s1 |
| InChIKey | STDCKISMORGPRW-FPOVZHCZSA-N |
| XLogP | 3.28 |
| TPSA | 134.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.64 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|