C31H32N4O6S2 — CID 147414190
[4-[(2S)-2-[[(2S)-2-(ethenoxycarbonylamino)-3-phenylpropanoyl]amino]-2-(4-ethyl-5-phenyl-1,3-thiazol-2-yl)ethyl]phenyl]sulfamic acid (PubChem CID 147414190) has the molecular formula C31H32N4O6S2 and a molecular weight of 620.75 g/mol. Its IUPAC name is [4-[(2S)-2-[[(2S)-2-(ethenoxycarbonylamino)-3-phenylpropanoyl]amino]-2-(4-ethyl-5-phenyl-1,3-thiazol-2-yl)ethyl]phenyl]sulfamic acid.
| Compound Name | [4-[(2S)-2-[[(2S)-2-(ethenoxycarbonylamino)-3-phenylpropanoyl]amino]-2-(4-ethyl-5-phenyl-1,3-thiazol-2-yl)ethyl]phenyl]sulfamic acid |
|---|---|
| PubChem CID | 147414190 |
| Molecular Formula | C31H32N4O6S2 |
| Molecular Weight | 620.75 g/mol |
| Exact Mass | 620.18 |
| IUPAC Name | [4-[(2S)-2-[[(2S)-2-(ethenoxycarbonylamino)-3-phenylpropanoyl]amino]-2-(4-ethyl-5-phenyl-1,3-thiazol-2-yl)ethyl]phenyl]sulfamic acid |
| SMILES | C=COC(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccc(NS(=O)(=O)O)cc1)c1nc(CC)c(-c2ccccc2)s1 |
| InChI | InChI=1S/C31H32N4O6S2/c1-3-25-28(23-13-9-6-10-14-23)42-30(33-25)27(20-22-15-17-24(18-16-22)35-43(38,39)40)32-29(36)26(34-31(37)41-4-2)19-21-11-7-5-8-12-21/h4-18,26-27,35H,2-3,19-20H2,1H3,(H,32,36)(H,34,37)(H,38,39,40)/t26-,27-/m0/s1 |
| InChIKey | DRESXAICYGGJLN-SVBPBHIXSA-N |
| XLogP | 5.47 |
| TPSA | 146.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.75 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|