C25H29N3O6S2 — CID 24815594
[4-[(2S)-2-[[(2S)-2-benzyl-3-ethoxy-3-oxopropanoyl]amino]-2-(4-ethyl-1,3-thiazol-2-yl)ethyl]phenyl]sulfamic acid (PubChem CID 24815594) has the molecular formula C25H29N3O6S2 and a molecular weight of 531.66 g/mol. Its IUPAC name is [4-[(2S)-2-[[(2S)-2-benzyl-3-ethoxy-3-oxopropanoyl]amino]-2-(4-ethyl-1,3-thiazol-2-yl)ethyl]phenyl]sulfamic acid.
| Compound Name | [4-[(2S)-2-[[(2S)-2-benzyl-3-ethoxy-3-oxopropanoyl]amino]-2-(4-ethyl-1,3-thiazol-2-yl)ethyl]phenyl]sulfamic acid |
|---|---|
| PubChem CID | 24815594 |
| Molecular Formula | C25H29N3O6S2 |
| Molecular Weight | 531.66 g/mol |
| Exact Mass | 531.15 |
| IUPAC Name | [4-[(2S)-2-[[(2S)-2-benzyl-3-ethoxy-3-oxopropanoyl]amino]-2-(4-ethyl-1,3-thiazol-2-yl)ethyl]phenyl]sulfamic acid |
| SMILES | CCOC(=O)[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccc(NS(=O)(=O)O)cc1)c1nc(CC)cs1 |
| InChI | InChI=1S/C25H29N3O6S2/c1-3-19-16-35-24(26-19)22(15-18-10-12-20(13-11-18)28-36(31,32)33)27-23(29)21(25(30)34-4-2)14-17-8-6-5-7-9-17/h5-13,16,21-22,28H,3-4,14-15H2,1-2H3,(H,27,29)(H,31,32,33)/t21-,22-/m0/s1 |
| InChIKey | RTVIFXYKKGNLCT-VXKWHMMOSA-N |
| XLogP | 3.74 |
| TPSA | 134.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.66 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|