C28H28FN3O4S2 — CID 66704689
[4-[2-(4-ethyl-1,3-thiazol-2-yl)-2-[[2-(2-fluorophenyl)-3-phenylpropanoyl]amino]ethyl]phenyl]sulfamic acid (PubChem CID 66704689) has the molecular formula C28H28FN3O4S2 and a molecular weight of 553.68 g/mol. Its IUPAC name is [4-[2-(4-ethyl-1,3-thiazol-2-yl)-2-[[2-(2-fluorophenyl)-3-phenylpropanoyl]amino]ethyl]phenyl]sulfamic acid.
| Compound Name | [4-[2-(4-ethyl-1,3-thiazol-2-yl)-2-[[2-(2-fluorophenyl)-3-phenylpropanoyl]amino]ethyl]phenyl]sulfamic acid |
|---|---|
| PubChem CID | 66704689 |
| Molecular Formula | C28H28FN3O4S2 |
| Molecular Weight | 553.68 g/mol |
| Exact Mass | 553.15 |
| IUPAC Name | [4-[2-(4-ethyl-1,3-thiazol-2-yl)-2-[[2-(2-fluorophenyl)-3-phenylpropanoyl]amino]ethyl]phenyl]sulfamic acid |
| SMILES | CCc1csc(C(Cc2ccc(NS(=O)(=O)O)cc2)NC(=O)C(Cc2ccccc2)c2ccccc2F)n1 |
| InChI | InChI=1S/C28H28FN3O4S2/c1-2-21-18-37-28(30-21)26(17-20-12-14-22(15-13-20)32-38(34,35)36)31-27(33)24(16-19-8-4-3-5-9-19)23-10-6-7-11-25(23)29/h3-15,18,24,26,32H,2,16-17H2,1H3,(H,31,33)(H,34,35,36) |
| InChIKey | NXOZFOXZLDWPDT-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 108.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.68 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|