C29H31N3O4S2 — CID 134426266
4-ethyl-2-[(1S)-1-[[2-(2-methoxyphenyl)-3-phenylpropanoyl]amino]-2-[4-(sulfinoamino)phenyl]ethyl]-1,3-thiazole (PubChem CID 134426266) has the molecular formula C29H31N3O4S2 and a molecular weight of 549.72 g/mol. Its IUPAC name is 4-ethyl-2-[(1S)-1-[[2-(2-methoxyphenyl)-3-phenylpropanoyl]amino]-2-[4-(sulfinoamino)phenyl]ethyl]-1,3-thiazole.
| Compound Name | 4-ethyl-2-[(1S)-1-[[2-(2-methoxyphenyl)-3-phenylpropanoyl]amino]-2-[4-(sulfinoamino)phenyl]ethyl]-1,3-thiazole |
|---|---|
| PubChem CID | 134426266 |
| Molecular Formula | C29H31N3O4S2 |
| Molecular Weight | 549.72 g/mol |
| Exact Mass | 549.18 |
| IUPAC Name | 4-ethyl-2-[(1S)-1-[[2-(2-methoxyphenyl)-3-phenylpropanoyl]amino]-2-[4-(sulfinoamino)phenyl]ethyl]-1,3-thiazole |
| SMILES | CCc1csc([C@H](Cc2ccc(NS(=O)O)cc2)NC(=O)C(Cc2ccccc2)c2ccccc2OC)n1 |
| InChI | InChI=1S/C29H31N3O4S2/c1-3-22-19-37-29(30-22)26(18-21-13-15-23(16-14-21)32-38(34)35)31-28(33)25(17-20-9-5-4-6-10-20)24-11-7-8-12-27(24)36-2/h4-16,19,25-26,32H,3,17-18H2,1-2H3,(H,31,33)(H,34,35)/t25?,26-/m0/s1 |
| InChIKey | UWSZEAWOLMJYQE-AMVUTOCUSA-N |
| XLogP | 5.69 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.72 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|