C24H28N4O4S2 — CID 134174056
2-[(1S)-1-[[(2S)-2-acetamido-3-phenylpropanoyl]amino]-2-[4-(sulfinoamino)phenyl]ethyl]-4-ethyl-1,3-thiazole (PubChem CID 134174056) has the molecular formula C24H28N4O4S2 and a molecular weight of 500.65 g/mol. Its IUPAC name is 2-[(1S)-1-[[(2S)-2-acetamido-3-phenylpropanoyl]amino]-2-[4-(sulfinoamino)phenyl]ethyl]-4-ethyl-1,3-thiazole.
| Compound Name | 2-[(1S)-1-[[(2S)-2-acetamido-3-phenylpropanoyl]amino]-2-[4-(sulfinoamino)phenyl]ethyl]-4-ethyl-1,3-thiazole |
|---|---|
| PubChem CID | 134174056 |
| Molecular Formula | C24H28N4O4S2 |
| Molecular Weight | 500.65 g/mol |
| Exact Mass | 500.16 |
| IUPAC Name | 2-[(1S)-1-[[(2S)-2-acetamido-3-phenylpropanoyl]amino]-2-[4-(sulfinoamino)phenyl]ethyl]-4-ethyl-1,3-thiazole |
| SMILES | CCc1csc([C@H](Cc2ccc(NS(=O)O)cc2)NC(=O)[C@H](Cc2ccccc2)NC(C)=O)n1 |
| InChI | InChI=1S/C24H28N4O4S2/c1-3-19-15-33-24(26-19)22(14-18-9-11-20(12-10-18)28-34(31)32)27-23(30)21(25-16(2)29)13-17-7-5-4-6-8-17/h4-12,15,21-22,28H,3,13-14H2,1-2H3,(H,25,29)(H,27,30)(H,31,32)/t21-,22-/m0/s1 |
| InChIKey | VXSXNOZBVPWMHM-VXKWHMMOSA-N |
| XLogP | 3.40 |
| TPSA | 120.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.65 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|