C19H27N5O5S2 — CID 167244433
2-[(1S)-1-[[2-(2-aminopropan-2-yloxycarbonylamino)acetyl]amino]-2-[4-(sulfinoamino)phenyl]ethyl]-4-ethyl-1,3-thiazole (PubChem CID 167244433) has the molecular formula C19H27N5O5S2 and a molecular weight of 469.59 g/mol. Its IUPAC name is 2-[(1S)-1-[[2-(2-aminopropan-2-yloxycarbonylamino)acetyl]amino]-2-[4-(sulfinoamino)phenyl]ethyl]-4-ethyl-1,3-thiazole.
| Compound Name | 2-[(1S)-1-[[2-(2-aminopropan-2-yloxycarbonylamino)acetyl]amino]-2-[4-(sulfinoamino)phenyl]ethyl]-4-ethyl-1,3-thiazole |
|---|---|
| PubChem CID | 167244433 |
| Molecular Formula | C19H27N5O5S2 |
| Molecular Weight | 469.59 g/mol |
| Exact Mass | 469.15 |
| IUPAC Name | 2-[(1S)-1-[[2-(2-aminopropan-2-yloxycarbonylamino)acetyl]amino]-2-[4-(sulfinoamino)phenyl]ethyl]-4-ethyl-1,3-thiazole |
| SMILES | CCc1csc([C@H](Cc2ccc(NS(=O)O)cc2)NC(=O)CNC(=O)OC(C)(C)N)n1 |
| InChI | InChI=1S/C19H27N5O5S2/c1-4-13-11-30-17(22-13)15(9-12-5-7-14(8-6-12)24-31(27)28)23-16(25)10-21-18(26)29-19(2,3)20/h5-8,11,15,24H,4,9-10,20H2,1-3H3,(H,21,26)(H,23,25)(H,27,28)/t15-/m0/s1 |
| InChIKey | HPQRGIMRGFTNRX-HNNXBMFYSA-N |
| XLogP | 2.08 |
| TPSA | 155.67 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.59 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|