C23H33N3O6S2 — CID 24815967
[4-[(2S)-2-(4-ethyl-1,3-thiazol-2-yl)-2-[[(2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonyl]butanoyl]amino]ethyl]phenyl]sulfamic acid (PubChem CID 24815967) has the molecular formula C23H33N3O6S2 and a molecular weight of 511.67 g/mol. Its IUPAC name is [4-[(2S)-2-(4-ethyl-1,3-thiazol-2-yl)-2-[[(2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonyl]butanoyl]amino]ethyl]phenyl]sulfamic acid.
| Compound Name | [4-[(2S)-2-(4-ethyl-1,3-thiazol-2-yl)-2-[[(2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonyl]butanoyl]amino]ethyl]phenyl]sulfamic acid |
|---|---|
| PubChem CID | 24815967 |
| Molecular Formula | C23H33N3O6S2 |
| Molecular Weight | 511.67 g/mol |
| Exact Mass | 511.18 |
| IUPAC Name | [4-[(2S)-2-(4-ethyl-1,3-thiazol-2-yl)-2-[[(2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonyl]butanoyl]amino]ethyl]phenyl]sulfamic acid |
| SMILES | CCc1csc([C@H](Cc2ccc(NS(=O)(=O)O)cc2)NC(=O)[C@@H](C(=O)OC(C)(C)C)C(C)C)n1 |
| InChI | InChI=1S/C23H33N3O6S2/c1-7-16-13-33-21(24-16)18(12-15-8-10-17(11-9-15)26-34(29,30)31)25-20(27)19(14(2)3)22(28)32-23(4,5)6/h8-11,13-14,18-19,26H,7,12H2,1-6H3,(H,25,27)(H,29,30,31)/t18-,19-/m0/s1 |
| InChIKey | WRBIYZCVHVNXAI-OALUTQOASA-N |
| XLogP | 3.93 |
| TPSA | 134.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.67 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|