C26H31N3O6S2 — CID 68695978
[4-[2-(4-ethyl-1,3-thiazol-2-yl)-2-[[3-[(2-methylpropan-2-yl)oxy]-3-oxo-2-phenylpropanoyl]amino]ethyl]phenyl]sulfamic acid (PubChem CID 68695978) has the molecular formula C26H31N3O6S2 and a molecular weight of 545.68 g/mol. Its IUPAC name is [4-[2-(4-ethyl-1,3-thiazol-2-yl)-2-[[3-[(2-methylpropan-2-yl)oxy]-3-oxo-2-phenylpropanoyl]amino]ethyl]phenyl]sulfamic acid.
| Compound Name | [4-[2-(4-ethyl-1,3-thiazol-2-yl)-2-[[3-[(2-methylpropan-2-yl)oxy]-3-oxo-2-phenylpropanoyl]amino]ethyl]phenyl]sulfamic acid |
|---|---|
| PubChem CID | 68695978 |
| Molecular Formula | C26H31N3O6S2 |
| Molecular Weight | 545.68 g/mol |
| Exact Mass | 545.17 |
| IUPAC Name | [4-[2-(4-ethyl-1,3-thiazol-2-yl)-2-[[3-[(2-methylpropan-2-yl)oxy]-3-oxo-2-phenylpropanoyl]amino]ethyl]phenyl]sulfamic acid |
| SMILES | CCc1csc(C(Cc2ccc(NS(=O)(=O)O)cc2)NC(=O)C(C(=O)OC(C)(C)C)c2ccccc2)n1 |
| InChI | InChI=1S/C26H31N3O6S2/c1-5-19-16-36-24(27-19)21(15-17-11-13-20(14-12-17)29-37(32,33)34)28-23(30)22(18-9-7-6-8-10-18)25(31)35-26(2,3)4/h6-14,16,21-22,29H,5,15H2,1-4H3,(H,28,30)(H,32,33,34) |
| InChIKey | HEUQGWRBJLQYHI-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 134.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.68 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|