C26H30N4O7S2 — CID 68696673
[4-[2-(4-ethyl-1,3-thiazol-2-yl)-2-[[2-[(3-methoxy-3-oxopropanoyl)amino]-3-phenylpropanoyl]amino]ethyl]phenyl]sulfamic acid (PubChem CID 68696673) has the molecular formula C26H30N4O7S2 and a molecular weight of 574.68 g/mol. Its IUPAC name is [4-[2-(4-ethyl-1,3-thiazol-2-yl)-2-[[2-[(3-methoxy-3-oxopropanoyl)amino]-3-phenylpropanoyl]amino]ethyl]phenyl]sulfamic acid.
| Compound Name | [4-[2-(4-ethyl-1,3-thiazol-2-yl)-2-[[2-[(3-methoxy-3-oxopropanoyl)amino]-3-phenylpropanoyl]amino]ethyl]phenyl]sulfamic acid |
|---|---|
| PubChem CID | 68696673 |
| Molecular Formula | C26H30N4O7S2 |
| Molecular Weight | 574.68 g/mol |
| Exact Mass | 574.16 |
| IUPAC Name | [4-[2-(4-ethyl-1,3-thiazol-2-yl)-2-[[2-[(3-methoxy-3-oxopropanoyl)amino]-3-phenylpropanoyl]amino]ethyl]phenyl]sulfamic acid |
| SMILES | CCc1csc(C(Cc2ccc(NS(=O)(=O)O)cc2)NC(=O)C(Cc2ccccc2)NC(=O)CC(=O)OC)n1 |
| InChI | InChI=1S/C26H30N4O7S2/c1-3-19-16-38-26(27-19)22(14-18-9-11-20(12-10-18)30-39(34,35)36)29-25(33)21(13-17-7-5-4-6-8-17)28-23(31)15-24(32)37-2/h4-12,16,21-22,30H,3,13-15H2,1-2H3,(H,28,31)(H,29,33)(H,34,35,36) |
| InChIKey | WZCFIKVTISSNHC-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 163.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.68 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|