C22H24ClN3O4S2 — CID 23642291
[4-[(2S)-2-[3-(3-chlorophenyl)propanoylamino]-2-(4-ethyl-1,3-thiazol-2-yl)ethyl]phenyl]sulfamic acid (PubChem CID 23642291) has the molecular formula C22H24ClN3O4S2 and a molecular weight of 494.04 g/mol. Its IUPAC name is [4-[(2S)-2-[3-(3-chlorophenyl)propanoylamino]-2-(4-ethyl-1,3-thiazol-2-yl)ethyl]phenyl]sulfamic acid.
| Compound Name | [4-[(2S)-2-[3-(3-chlorophenyl)propanoylamino]-2-(4-ethyl-1,3-thiazol-2-yl)ethyl]phenyl]sulfamic acid |
|---|---|
| PubChem CID | 23642291 |
| Molecular Formula | C22H24ClN3O4S2 |
| Molecular Weight | 494.04 g/mol |
| Exact Mass | 493.09 |
| IUPAC Name | [4-[(2S)-2-[3-(3-chlorophenyl)propanoylamino]-2-(4-ethyl-1,3-thiazol-2-yl)ethyl]phenyl]sulfamic acid |
| SMILES | CCc1csc([C@H](Cc2ccc(NS(=O)(=O)O)cc2)NC(=O)CCc2cccc(Cl)c2)n1 |
| InChI | InChI=1S/C22H24ClN3O4S2/c1-2-18-14-31-22(24-18)20(13-16-6-9-19(10-7-16)26-32(28,29)30)25-21(27)11-8-15-4-3-5-17(23)12-15/h3-7,9-10,12,14,20,26H,2,8,11,13H2,1H3,(H,25,27)(H,28,29,30)/t20-/m0/s1 |
| InChIKey | STTNVVHPOLOFHV-FQEVSTJZSA-N |
| XLogP | 4.61 |
| TPSA | 108.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.04 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|