C23H24IN3O4S2 — CID 90445674
N-[4-[(2S)-2-(4-ethyl-1,3-thiazol-2-yl)-2-[(4-oxo-4-phenylbutanoyl)amino]ethyl]phenyl]sulfamoyl iodide (PubChem CID 90445674) has the molecular formula C23H24IN3O4S2 and a molecular weight of 597.50 g/mol. Its IUPAC name is N-[4-[(2S)-2-(4-ethyl-1,3-thiazol-2-yl)-2-[(4-oxo-4-phenylbutanoyl)amino]ethyl]phenyl]sulfamoyl iodide.
| Compound Name | N-[4-[(2S)-2-(4-ethyl-1,3-thiazol-2-yl)-2-[(4-oxo-4-phenylbutanoyl)amino]ethyl]phenyl]sulfamoyl iodide |
|---|---|
| PubChem CID | 90445674 |
| Molecular Formula | C23H24IN3O4S2 |
| Molecular Weight | 597.50 g/mol |
| Exact Mass | 597.03 |
| IUPAC Name | N-[4-[(2S)-2-(4-ethyl-1,3-thiazol-2-yl)-2-[(4-oxo-4-phenylbutanoyl)amino]ethyl]phenyl]sulfamoyl iodide |
| SMILES | CCc1csc([C@H](Cc2ccc(NS(=O)(=O)I)cc2)NC(=O)CCC(=O)c2ccccc2)n1 |
| InChI | InChI=1S/C23H24IN3O4S2/c1-2-18-15-32-23(25-18)20(14-16-8-10-19(11-9-16)27-33(24,30)31)26-22(29)13-12-21(28)17-6-4-3-5-7-17/h3-11,15,20,27H,2,12-14H2,1H3,(H,26,29)/t20-/m0/s1 |
| InChIKey | IUFDJPXVZBLHAI-FQEVSTJZSA-N |
| XLogP | 4.86 |
| TPSA | 105.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.50 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|