C20H24N4O4S3 — CID 24857208
[4-[(2R)-2-[[2-(2,4-dimethyl-1,3-thiazol-5-yl)acetyl]amino]-2-(4-ethyl-1,3-thiazol-2-yl)ethyl]phenyl]sulfamic acid (PubChem CID 24857208) has the molecular formula C20H24N4O4S3 and a molecular weight of 480.64 g/mol. Its IUPAC name is [4-[(2R)-2-[[2-(2,4-dimethyl-1,3-thiazol-5-yl)acetyl]amino]-2-(4-ethyl-1,3-thiazol-2-yl)ethyl]phenyl]sulfamic acid.
| Compound Name | [4-[(2R)-2-[[2-(2,4-dimethyl-1,3-thiazol-5-yl)acetyl]amino]-2-(4-ethyl-1,3-thiazol-2-yl)ethyl]phenyl]sulfamic acid |
|---|---|
| PubChem CID | 24857208 |
| Molecular Formula | C20H24N4O4S3 |
| Molecular Weight | 480.64 g/mol |
| Exact Mass | 480.10 |
| IUPAC Name | [4-[(2R)-2-[[2-(2,4-dimethyl-1,3-thiazol-5-yl)acetyl]amino]-2-(4-ethyl-1,3-thiazol-2-yl)ethyl]phenyl]sulfamic acid |
| SMILES | CCc1csc([C@@H](Cc2ccc(NS(=O)(=O)O)cc2)NC(=O)Cc2sc(C)nc2C)n1 |
| InChI | InChI=1S/C20H24N4O4S3/c1-4-15-11-29-20(22-15)17(23-19(25)10-18-12(2)21-13(3)30-18)9-14-5-7-16(8-6-14)24-31(26,27)28/h5-8,11,17,24H,4,9-10H2,1-3H3,(H,23,25)(H,26,27,28)/t17-/m1/s1 |
| InChIKey | MSDVQPHHJNTWHL-QGZVFWFLSA-N |
| XLogP | 3.64 |
| TPSA | 121.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.64 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|