C24H27N3O6S2 — CID 166716537
[4-[(2S)-2-[[2-(4-acetyl-3-methoxyphenyl)acetyl]amino]-2-(4-ethyl-1,3-thiazol-2-yl)ethyl]phenyl]sulfamic acid (PubChem CID 166716537) has the molecular formula C24H27N3O6S2 and a molecular weight of 517.63 g/mol. Its IUPAC name is [4-[(2S)-2-[[2-(4-acetyl-3-methoxyphenyl)acetyl]amino]-2-(4-ethyl-1,3-thiazol-2-yl)ethyl]phenyl]sulfamic acid.
| Compound Name | [4-[(2S)-2-[[2-(4-acetyl-3-methoxyphenyl)acetyl]amino]-2-(4-ethyl-1,3-thiazol-2-yl)ethyl]phenyl]sulfamic acid |
|---|---|
| PubChem CID | 166716537 |
| Molecular Formula | C24H27N3O6S2 |
| Molecular Weight | 517.63 g/mol |
| Exact Mass | 517.13 |
| IUPAC Name | [4-[(2S)-2-[[2-(4-acetyl-3-methoxyphenyl)acetyl]amino]-2-(4-ethyl-1,3-thiazol-2-yl)ethyl]phenyl]sulfamic acid |
| SMILES | CCc1csc([C@H](Cc2ccc(NS(=O)(=O)O)cc2)NC(=O)Cc2ccc(C(C)=O)c(OC)c2)n1 |
| InChI | InChI=1S/C24H27N3O6S2/c1-4-18-14-34-24(25-18)21(11-16-5-8-19(9-6-16)27-35(30,31)32)26-23(29)13-17-7-10-20(15(2)28)22(12-17)33-3/h5-10,12,14,21,27H,4,11,13H2,1-3H3,(H,26,29)(H,30,31,32)/t21-/m0/s1 |
| InChIKey | LYTPEIYOGFGLNU-NRFANRHFSA-N |
| XLogP | 3.77 |
| TPSA | 134.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.63 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|