C23H27N3O4S2 — CID 134174169
4-ethyl-2-[(1S)-1-[3-(3-methoxyphenyl)propanoylamino]-2-[4-(sulfinoamino)phenyl]ethyl]-1,3-thiazole (PubChem CID 134174169) has the molecular formula C23H27N3O4S2 and a molecular weight of 473.62 g/mol. Its IUPAC name is 4-ethyl-2-[(1S)-1-[3-(3-methoxyphenyl)propanoylamino]-2-[4-(sulfinoamino)phenyl]ethyl]-1,3-thiazole.
| Compound Name | 4-ethyl-2-[(1S)-1-[3-(3-methoxyphenyl)propanoylamino]-2-[4-(sulfinoamino)phenyl]ethyl]-1,3-thiazole |
|---|---|
| PubChem CID | 134174169 |
| Molecular Formula | C23H27N3O4S2 |
| Molecular Weight | 473.62 g/mol |
| Exact Mass | 473.14 |
| IUPAC Name | 4-ethyl-2-[(1S)-1-[3-(3-methoxyphenyl)propanoylamino]-2-[4-(sulfinoamino)phenyl]ethyl]-1,3-thiazole |
| SMILES | CCc1csc([C@H](Cc2ccc(NS(=O)O)cc2)NC(=O)CCc2cccc(OC)c2)n1 |
| InChI | InChI=1S/C23H27N3O4S2/c1-3-18-15-31-23(24-18)21(14-17-7-10-19(11-8-17)26-32(28)29)25-22(27)12-9-16-5-4-6-20(13-16)30-2/h4-8,10-11,13,15,21,26H,3,9,12,14H2,1-2H3,(H,25,27)(H,28,29)/t21-/m0/s1 |
| InChIKey | WLEUQSXSJAQXPB-NRFANRHFSA-N |
| XLogP | 4.30 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.62 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|