C21H23FN3O3S2- — CID 146360455
4-ethyl-2-[(1S)-1-[[2-(2-fluorocyclohexa-1,3-dien-1-yl)acetyl]amino]-2-[4-(sulfinatoamino)phenyl]ethyl]-1,3-thiazole (PubChem CID 146360455) has the molecular formula C21H23FN3O3S2- and a molecular weight of 448.57 g/mol. Its IUPAC name is 4-ethyl-2-[(1S)-1-[[2-(2-fluorocyclohexa-1,3-dien-1-yl)acetyl]amino]-2-[4-(sulfinatoamino)phenyl]ethyl]-1,3-thiazole.
| Compound Name | 4-ethyl-2-[(1S)-1-[[2-(2-fluorocyclohexa-1,3-dien-1-yl)acetyl]amino]-2-[4-(sulfinatoamino)phenyl]ethyl]-1,3-thiazole |
|---|---|
| PubChem CID | 146360455 |
| Molecular Formula | C21H23FN3O3S2- |
| Molecular Weight | 448.57 g/mol |
| Exact Mass | 448.12 |
| IUPAC Name | 4-ethyl-2-[(1S)-1-[[2-(2-fluorocyclohexa-1,3-dien-1-yl)acetyl]amino]-2-[4-(sulfinatoamino)phenyl]ethyl]-1,3-thiazole |
| SMILES | CCc1csc([C@H](Cc2ccc(NS(=O)[O-])cc2)NC(=O)CC2=C(F)C=CCC2)n1 |
| InChI | InChI=1S/C21H24FN3O3S2/c1-2-16-13-29-21(23-16)19(11-14-7-9-17(10-8-14)25-30(27)28)24-20(26)12-15-5-3-4-6-18(15)22/h4,6-10,13,19,25H,2-3,5,11-12H2,1H3,(H,24,26)(H,27,28)/p-1/t19-/m0/s1 |
| InChIKey | HJSCTEKFFHXSGQ-IBGZPJMESA-M |
| XLogP | 4.28 |
| TPSA | 94.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.57 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|