C21H23N3O4S2 — CID 134174033
4-ethyl-2-[(1S)-1-[[2-(3-hydroxyphenyl)acetyl]amino]-2-[4-(sulfinoamino)phenyl]ethyl]-1,3-thiazole (PubChem CID 134174033) has the molecular formula C21H23N3O4S2 and a molecular weight of 445.57 g/mol. Its IUPAC name is 4-ethyl-2-[(1S)-1-[[2-(3-hydroxyphenyl)acetyl]amino]-2-[4-(sulfinoamino)phenyl]ethyl]-1,3-thiazole.
| Compound Name | 4-ethyl-2-[(1S)-1-[[2-(3-hydroxyphenyl)acetyl]amino]-2-[4-(sulfinoamino)phenyl]ethyl]-1,3-thiazole |
|---|---|
| PubChem CID | 134174033 |
| Molecular Formula | C21H23N3O4S2 |
| Molecular Weight | 445.57 g/mol |
| Exact Mass | 445.11 |
| IUPAC Name | 4-ethyl-2-[(1S)-1-[[2-(3-hydroxyphenyl)acetyl]amino]-2-[4-(sulfinoamino)phenyl]ethyl]-1,3-thiazole |
| SMILES | CCc1csc([C@H](Cc2ccc(NS(=O)O)cc2)NC(=O)Cc2cccc(O)c2)n1 |
| InChI | InChI=1S/C21H23N3O4S2/c1-2-16-13-29-21(22-16)19(11-14-6-8-17(9-7-14)24-30(27)28)23-20(26)12-15-4-3-5-18(25)10-15/h3-10,13,19,24-25H,2,11-12H2,1H3,(H,23,26)(H,27,28)/t19-/m0/s1 |
| InChIKey | ODEMWLJDNALWTN-IBGZPJMESA-N |
| XLogP | 3.60 |
| TPSA | 111.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.57 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|