C21H23N3O5S2 — CID 66847772
[2-[2-(4-ethyl-1,3-thiazol-2-yl)-2-[[2-(3-hydroxyphenyl)acetyl]amino]ethyl]phenyl]sulfamic acid (PubChem CID 66847772) has the molecular formula C21H23N3O5S2 and a molecular weight of 461.57 g/mol. Its IUPAC name is [2-[2-(4-ethyl-1,3-thiazol-2-yl)-2-[[2-(3-hydroxyphenyl)acetyl]amino]ethyl]phenyl]sulfamic acid.
| Compound Name | [2-[2-(4-ethyl-1,3-thiazol-2-yl)-2-[[2-(3-hydroxyphenyl)acetyl]amino]ethyl]phenyl]sulfamic acid |
|---|---|
| PubChem CID | 66847772 |
| Molecular Formula | C21H23N3O5S2 |
| Molecular Weight | 461.57 g/mol |
| Exact Mass | 461.11 |
| IUPAC Name | [2-[2-(4-ethyl-1,3-thiazol-2-yl)-2-[[2-(3-hydroxyphenyl)acetyl]amino]ethyl]phenyl]sulfamic acid |
| SMILES | CCc1csc(C(Cc2ccccc2NS(=O)(=O)O)NC(=O)Cc2cccc(O)c2)n1 |
| InChI | InChI=1S/C21H23N3O5S2/c1-2-16-13-30-21(22-16)19(23-20(26)11-14-6-5-8-17(25)10-14)12-15-7-3-4-9-18(15)24-31(27,28)29/h3-10,13,19,24-25H,2,11-12H2,1H3,(H,23,26)(H,27,28,29) |
| InChIKey | AVDMKPWIJWKTNI-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 128.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.57 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|