C29H31N3O3S2 — CID 134426524
4-ethyl-2-[(1S)-1-[[2-(3-methylphenyl)-3-phenylpropanoyl]amino]-2-[4-(sulfinoamino)phenyl]ethyl]-1,3-thiazole (PubChem CID 134426524) has the molecular formula C29H31N3O3S2 and a molecular weight of 533.72 g/mol. Its IUPAC name is 4-ethyl-2-[(1S)-1-[[2-(3-methylphenyl)-3-phenylpropanoyl]amino]-2-[4-(sulfinoamino)phenyl]ethyl]-1,3-thiazole.
| Compound Name | 4-ethyl-2-[(1S)-1-[[2-(3-methylphenyl)-3-phenylpropanoyl]amino]-2-[4-(sulfinoamino)phenyl]ethyl]-1,3-thiazole |
|---|---|
| PubChem CID | 134426524 |
| Molecular Formula | C29H31N3O3S2 |
| Molecular Weight | 533.72 g/mol |
| Exact Mass | 533.18 |
| IUPAC Name | 4-ethyl-2-[(1S)-1-[[2-(3-methylphenyl)-3-phenylpropanoyl]amino]-2-[4-(sulfinoamino)phenyl]ethyl]-1,3-thiazole |
| SMILES | CCc1csc([C@H](Cc2ccc(NS(=O)O)cc2)NC(=O)C(Cc2ccccc2)c2cccc(C)c2)n1 |
| InChI | InChI=1S/C29H31N3O3S2/c1-3-24-19-36-29(30-24)27(18-22-12-14-25(15-13-22)32-37(34)35)31-28(33)26(17-21-9-5-4-6-10-21)23-11-7-8-20(2)16-23/h4-16,19,26-27,32H,3,17-18H2,1-2H3,(H,31,33)(H,34,35)/t26?,27-/m0/s1 |
| InChIKey | UTVPTZRATRKGGP-GEVKEYJPSA-N |
| XLogP | 5.99 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.72 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|