C29H31N3O5S2 — CID 123864992
[2-(4-ethyl-1,3-thiazol-2-yl)-2-[[2-(3-methoxyphenyl)-3-phenylpropanoyl]amino]ethyl]-phenylsulfamic acid (PubChem CID 123864992) has the molecular formula C29H31N3O5S2 and a molecular weight of 565.72 g/mol. Its IUPAC name is [2-(4-ethyl-1,3-thiazol-2-yl)-2-[[2-(3-methoxyphenyl)-3-phenylpropanoyl]amino]ethyl]-phenylsulfamic acid.
| Compound Name | [2-(4-ethyl-1,3-thiazol-2-yl)-2-[[2-(3-methoxyphenyl)-3-phenylpropanoyl]amino]ethyl]-phenylsulfamic acid |
|---|---|
| PubChem CID | 123864992 |
| Molecular Formula | C29H31N3O5S2 |
| Molecular Weight | 565.72 g/mol |
| Exact Mass | 565.17 |
| IUPAC Name | [2-(4-ethyl-1,3-thiazol-2-yl)-2-[[2-(3-methoxyphenyl)-3-phenylpropanoyl]amino]ethyl]-phenylsulfamic acid |
| SMILES | CCc1csc(C(CN(c2ccccc2)S(=O)(=O)O)NC(=O)C(Cc2ccccc2)c2cccc(OC)c2)n1 |
| InChI | InChI=1S/C29H31N3O5S2/c1-3-23-20-38-29(30-23)27(19-32(39(34,35)36)24-14-8-5-9-15-24)31-28(33)26(17-21-11-6-4-7-12-21)22-13-10-16-25(18-22)37-2/h4-16,18,20,26-27H,3,17,19H2,1-2H3,(H,31,33)(H,34,35,36) |
| InChIKey | JWIWMXCOXDUHES-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 108.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.72 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|