C20H29N3O7S2 — CID 167156187
[4-[(2S)-2-[4-(2-ethoxy-2-hydroxyethyl)-1,3-thiazol-2-yl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]phenyl]sulfamic acid (PubChem CID 167156187) has the molecular formula C20H29N3O7S2 and a molecular weight of 487.60 g/mol. Its IUPAC name is [4-[(2S)-2-[4-(2-ethoxy-2-hydroxyethyl)-1,3-thiazol-2-yl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]phenyl]sulfamic acid.
| Compound Name | [4-[(2S)-2-[4-(2-ethoxy-2-hydroxyethyl)-1,3-thiazol-2-yl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]phenyl]sulfamic acid |
|---|---|
| PubChem CID | 167156187 |
| Molecular Formula | C20H29N3O7S2 |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.14 |
| IUPAC Name | [4-[(2S)-2-[4-(2-ethoxy-2-hydroxyethyl)-1,3-thiazol-2-yl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]phenyl]sulfamic acid |
| SMILES | CCOC(O)Cc1csc([C@H](Cc2ccc(NS(=O)(=O)O)cc2)NC(=O)OC(C)(C)C)n1 |
| InChI | InChI=1S/C20H29N3O7S2/c1-5-29-17(24)11-15-12-31-18(21-15)16(22-19(25)30-20(2,3)4)10-13-6-8-14(9-7-13)23-32(26,27)28/h6-9,12,16-17,23-24H,5,10-11H2,1-4H3,(H,22,25)(H,26,27,28)/t16-,17?/m0/s1 |
| InChIKey | FHPAJXLXUUCLCD-BHWOMJMDSA-N |
| XLogP | 3.06 |
| TPSA | 147.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|