C20H29N3O6S2 — CID 135301391
[4-[(2S)-2-[4-(2-ethoxy-2-oxoethyl)-1,3-thiazol-2-yl]-2-[(2-methylpropan-2-yl)oxymethylamino]ethyl]phenyl]sulfamic acid (PubChem CID 135301391) has the molecular formula C20H29N3O6S2 and a molecular weight of 471.60 g/mol. Its IUPAC name is [4-[(2S)-2-[4-(2-ethoxy-2-oxoethyl)-1,3-thiazol-2-yl]-2-[(2-methylpropan-2-yl)oxymethylamino]ethyl]phenyl]sulfamic acid.
| Compound Name | [4-[(2S)-2-[4-(2-ethoxy-2-oxoethyl)-1,3-thiazol-2-yl]-2-[(2-methylpropan-2-yl)oxymethylamino]ethyl]phenyl]sulfamic acid |
|---|---|
| PubChem CID | 135301391 |
| Molecular Formula | C20H29N3O6S2 |
| Molecular Weight | 471.60 g/mol |
| Exact Mass | 471.15 |
| IUPAC Name | [4-[(2S)-2-[4-(2-ethoxy-2-oxoethyl)-1,3-thiazol-2-yl]-2-[(2-methylpropan-2-yl)oxymethylamino]ethyl]phenyl]sulfamic acid |
| SMILES | CCOC(=O)Cc1csc([C@H](Cc2ccc(NS(=O)(=O)O)cc2)NCOC(C)(C)C)n1 |
| InChI | InChI=1S/C20H29N3O6S2/c1-5-28-18(24)11-16-12-30-19(22-16)17(21-13-29-20(2,3)4)10-14-6-8-15(9-7-14)23-31(25,26)27/h6-9,12,17,21,23H,5,10-11,13H2,1-4H3,(H,25,26,27)/t17-/m0/s1 |
| InChIKey | DIXUFVDQZQSZPU-KRWDZBQOSA-N |
| XLogP | 3.11 |
| TPSA | 126.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.60 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|