C23H29N3O3S2 — CID 141475878
[4-[(2S)-2-(4-benzyl-1,3-thiazol-2-yl)-2-(2,2-dimethylpropylamino)ethyl]phenyl]sulfamic acid (PubChem CID 141475878) has the molecular formula C23H29N3O3S2 and a molecular weight of 459.64 g/mol. Its IUPAC name is [4-[(2S)-2-(4-benzyl-1,3-thiazol-2-yl)-2-(2,2-dimethylpropylamino)ethyl]phenyl]sulfamic acid.
| Compound Name | [4-[(2S)-2-(4-benzyl-1,3-thiazol-2-yl)-2-(2,2-dimethylpropylamino)ethyl]phenyl]sulfamic acid |
|---|---|
| PubChem CID | 141475878 |
| Molecular Formula | C23H29N3O3S2 |
| Molecular Weight | 459.64 g/mol |
| Exact Mass | 459.17 |
| IUPAC Name | [4-[(2S)-2-(4-benzyl-1,3-thiazol-2-yl)-2-(2,2-dimethylpropylamino)ethyl]phenyl]sulfamic acid |
| SMILES | CC(C)(C)CN[C@@H](Cc1ccc(NS(=O)(=O)O)cc1)c1nc(Cc2ccccc2)cs1 |
| InChI | InChI=1S/C23H29N3O3S2/c1-23(2,3)16-24-21(14-18-9-11-19(12-10-18)26-31(27,28)29)22-25-20(15-30-22)13-17-7-5-4-6-8-17/h4-12,15,21,24,26H,13-14,16H2,1-3H3,(H,27,28,29)/t21-/m0/s1 |
| InChIKey | YUTAGZLVANVKKF-NRFANRHFSA-N |
| XLogP | 4.87 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.64 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|