C18H17N3O5S2 — CID 71225551
[1-(4-phenyl-1,3-thiazol-2-yl)-2-[4-(sulfoamino)phenyl]ethyl]carbamic acid (PubChem CID 71225551) has the molecular formula C18H17N3O5S2 and a molecular weight of 419.48 g/mol. Its IUPAC name is [1-(4-phenyl-1,3-thiazol-2-yl)-2-[4-(sulfoamino)phenyl]ethyl]carbamic acid.
| Compound Name | [1-(4-phenyl-1,3-thiazol-2-yl)-2-[4-(sulfoamino)phenyl]ethyl]carbamic acid |
|---|---|
| PubChem CID | 71225551 |
| Molecular Formula | C18H17N3O5S2 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.06 |
| IUPAC Name | [1-(4-phenyl-1,3-thiazol-2-yl)-2-[4-(sulfoamino)phenyl]ethyl]carbamic acid |
| SMILES | O=C(O)NC(Cc1ccc(NS(=O)(=O)O)cc1)c1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C18H17N3O5S2/c22-18(23)20-15(10-12-6-8-14(9-7-12)21-28(24,25)26)17-19-16(11-27-17)13-4-2-1-3-5-13/h1-9,11,15,20-21H,10H2,(H,22,23)(H,24,25,26) |
| InChIKey | KRTWSPUPAHGNHR-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 128.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|