C28H28N4O6S2 — CID 174692267
amino 4-[(2S)-2-[[(2S)-2-(methoxycarbonylamino)-3-phenylpropanoyl]amino]-2-(4-phenyl-1,3-thiazol-2-yl)ethyl]benzenesulfonate (PubChem CID 174692267) has the molecular formula C28H28N4O6S2 and a molecular weight of 580.69 g/mol. Its IUPAC name is amino 4-[(2S)-2-[[(2S)-2-(methoxycarbonylamino)-3-phenylpropanoyl]amino]-2-(4-phenyl-1,3-thiazol-2-yl)ethyl]benzenesulfonate.
| Compound Name | amino 4-[(2S)-2-[[(2S)-2-(methoxycarbonylamino)-3-phenylpropanoyl]amino]-2-(4-phenyl-1,3-thiazol-2-yl)ethyl]benzenesulfonate |
|---|---|
| PubChem CID | 174692267 |
| Molecular Formula | C28H28N4O6S2 |
| Molecular Weight | 580.69 g/mol |
| Exact Mass | 580.15 |
| IUPAC Name | amino 4-[(2S)-2-[[(2S)-2-(methoxycarbonylamino)-3-phenylpropanoyl]amino]-2-(4-phenyl-1,3-thiazol-2-yl)ethyl]benzenesulfonate |
| SMILES | COC(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccc(S(=O)(=O)ON)cc1)c1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C28H28N4O6S2/c1-37-28(34)32-23(16-19-8-4-2-5-9-19)26(33)30-24(17-20-12-14-22(15-13-20)40(35,36)38-29)27-31-25(18-39-27)21-10-6-3-7-11-21/h2-15,18,23-24H,16-17,29H2,1H3,(H,30,33)(H,32,34)/t23-,24-/m0/s1 |
| InChIKey | GRLGIEYQCAVOQT-ZEQRLZLVSA-N |
| XLogP | 3.76 |
| TPSA | 149.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.69 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|