C26H26N4O3S2 — CID 164540451
methyl N-[1-[[2-(4-aminophenyl)-1-(4-thiophen-2-yl-1,3-thiazol-2-yl)ethyl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate (PubChem CID 164540451) has the molecular formula C26H26N4O3S2 and a molecular weight of 506.65 g/mol. Its IUPAC name is methyl N-[1-[[2-(4-aminophenyl)-1-(4-thiophen-2-yl-1,3-thiazol-2-yl)ethyl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate.
| Compound Name | methyl N-[1-[[2-(4-aminophenyl)-1-(4-thiophen-2-yl-1,3-thiazol-2-yl)ethyl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 164540451 |
| Molecular Formula | C26H26N4O3S2 |
| Molecular Weight | 506.65 g/mol |
| Exact Mass | 506.14 |
| IUPAC Name | methyl N-[1-[[2-(4-aminophenyl)-1-(4-thiophen-2-yl-1,3-thiazol-2-yl)ethyl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate |
| SMILES | COC(=O)NC(Cc1ccccc1)C(=O)NC(Cc1ccc(N)cc1)c1nc(-c2cccs2)cs1 |
| InChI | InChI=1S/C26H26N4O3S2/c1-33-26(32)30-20(14-17-6-3-2-4-7-17)24(31)28-21(15-18-9-11-19(27)12-10-18)25-29-22(16-35-25)23-8-5-13-34-23/h2-13,16,20-21H,14-15,27H2,1H3,(H,28,31)(H,30,32) |
| InChIKey | JAUFMZQXTPYKCC-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.65 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|