C23H27N3O4S2 — CID 66695061
[4-[2-(2,2-dimethylpropanoylamino)-2-(5-methyl-4-phenyl-1,3-thiazol-2-yl)ethyl]phenyl]sulfamic acid (PubChem CID 66695061) has the molecular formula C23H27N3O4S2 and a molecular weight of 473.62 g/mol. Its IUPAC name is [4-[2-(2,2-dimethylpropanoylamino)-2-(5-methyl-4-phenyl-1,3-thiazol-2-yl)ethyl]phenyl]sulfamic acid.
| Compound Name | [4-[2-(2,2-dimethylpropanoylamino)-2-(5-methyl-4-phenyl-1,3-thiazol-2-yl)ethyl]phenyl]sulfamic acid |
|---|---|
| PubChem CID | 66695061 |
| Molecular Formula | C23H27N3O4S2 |
| Molecular Weight | 473.62 g/mol |
| Exact Mass | 473.14 |
| IUPAC Name | [4-[2-(2,2-dimethylpropanoylamino)-2-(5-methyl-4-phenyl-1,3-thiazol-2-yl)ethyl]phenyl]sulfamic acid |
| SMILES | Cc1sc(C(Cc2ccc(NS(=O)(=O)O)cc2)NC(=O)C(C)(C)C)nc1-c1ccccc1 |
| InChI | InChI=1S/C23H27N3O4S2/c1-15-20(17-8-6-5-7-9-17)25-21(31-15)19(24-22(27)23(2,3)4)14-16-10-12-18(13-11-16)26-32(28,29)30/h5-13,19,26H,14H2,1-4H3,(H,24,27)(H,28,29,30) |
| InChIKey | ZOLAHFBNGNECSE-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 108.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.62 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|