C24H29N3O6S2 — CID 24816139
[4-[(2S)-2-[4-(2,4-dimethoxyphenyl)-1,3-thiazol-2-yl]-2-(2,2-dimethylpropanoylamino)ethyl]phenyl]sulfamic acid (PubChem CID 24816139) has the molecular formula C24H29N3O6S2 and a molecular weight of 519.65 g/mol. Its IUPAC name is [4-[(2S)-2-[4-(2,4-dimethoxyphenyl)-1,3-thiazol-2-yl]-2-(2,2-dimethylpropanoylamino)ethyl]phenyl]sulfamic acid.
| Compound Name | [4-[(2S)-2-[4-(2,4-dimethoxyphenyl)-1,3-thiazol-2-yl]-2-(2,2-dimethylpropanoylamino)ethyl]phenyl]sulfamic acid |
|---|---|
| PubChem CID | 24816139 |
| Molecular Formula | C24H29N3O6S2 |
| Molecular Weight | 519.65 g/mol |
| Exact Mass | 519.15 |
| IUPAC Name | [4-[(2S)-2-[4-(2,4-dimethoxyphenyl)-1,3-thiazol-2-yl]-2-(2,2-dimethylpropanoylamino)ethyl]phenyl]sulfamic acid |
| SMILES | COc1ccc(-c2csc([C@H](Cc3ccc(NS(=O)(=O)O)cc3)NC(=O)C(C)(C)C)n2)c(OC)c1 |
| InChI | InChI=1S/C24H29N3O6S2/c1-24(2,3)23(28)26-19(12-15-6-8-16(9-7-15)27-35(29,30)31)22-25-20(14-34-22)18-11-10-17(32-4)13-21(18)33-5/h6-11,13-14,19,27H,12H2,1-5H3,(H,26,28)(H,29,30,31)/t19-/m0/s1 |
| InChIKey | RQOCHQZZERGEFT-IBGZPJMESA-N |
| XLogP | 4.49 |
| TPSA | 126.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.65 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|