C24H29N3O6S2 — CID 130434850
[4-[(2S)-2-(2,2-dimethylpropanoylamino)-2-[4-(2,3,7,8-tetrahydro-1,4-benzodioxin-7-yl)-1,3-thiazol-2-yl]ethyl]phenyl]sulfamic acid (PubChem CID 130434850) has the molecular formula C24H29N3O6S2 and a molecular weight of 519.65 g/mol. Its IUPAC name is [4-[(2S)-2-(2,2-dimethylpropanoylamino)-2-[4-(2,3,7,8-tetrahydro-1,4-benzodioxin-7-yl)-1,3-thiazol-2-yl]ethyl]phenyl]sulfamic acid.
| Compound Name | [4-[(2S)-2-(2,2-dimethylpropanoylamino)-2-[4-(2,3,7,8-tetrahydro-1,4-benzodioxin-7-yl)-1,3-thiazol-2-yl]ethyl]phenyl]sulfamic acid |
|---|---|
| PubChem CID | 130434850 |
| Molecular Formula | C24H29N3O6S2 |
| Molecular Weight | 519.65 g/mol |
| Exact Mass | 519.15 |
| IUPAC Name | [4-[(2S)-2-(2,2-dimethylpropanoylamino)-2-[4-(2,3,7,8-tetrahydro-1,4-benzodioxin-7-yl)-1,3-thiazol-2-yl]ethyl]phenyl]sulfamic acid |
| SMILES | CC(C)(C)C(=O)N[C@@H](Cc1ccc(NS(=O)(=O)O)cc1)c1nc(C2C=CC3=C(C2)OCCO3)cs1 |
| InChI | InChI=1S/C24H29N3O6S2/c1-24(2,3)23(28)26-18(12-15-4-7-17(8-5-15)27-35(29,30)31)22-25-19(14-34-22)16-6-9-20-21(13-16)33-11-10-32-20/h4-9,14,16,18,27H,10-13H2,1-3H3,(H,26,28)(H,29,30,31)/t16?,18-/m0/s1 |
| InChIKey | OOUJHXYDHHMEPL-DAFXYXGESA-N |
| XLogP | 4.11 |
| TPSA | 126.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.65 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|