C21H23F2N3O3S2 — CID 146360587
2-[(1S)-1-[[2-(4,5-difluorocyclohexa-1,5-dien-1-yl)acetyl]amino]-2-[4-(sulfinoamino)phenyl]ethyl]-4-ethyl-1,3-thiazole (PubChem CID 146360587) has the molecular formula C21H23F2N3O3S2 and a molecular weight of 467.56 g/mol. Its IUPAC name is 2-[(1S)-1-[[2-(4,5-difluorocyclohexa-1,5-dien-1-yl)acetyl]amino]-2-[4-(sulfinoamino)phenyl]ethyl]-4-ethyl-1,3-thiazole.
| Compound Name | 2-[(1S)-1-[[2-(4,5-difluorocyclohexa-1,5-dien-1-yl)acetyl]amino]-2-[4-(sulfinoamino)phenyl]ethyl]-4-ethyl-1,3-thiazole |
|---|---|
| PubChem CID | 146360587 |
| Molecular Formula | C21H23F2N3O3S2 |
| Molecular Weight | 467.56 g/mol |
| Exact Mass | 467.11 |
| IUPAC Name | 2-[(1S)-1-[[2-(4,5-difluorocyclohexa-1,5-dien-1-yl)acetyl]amino]-2-[4-(sulfinoamino)phenyl]ethyl]-4-ethyl-1,3-thiazole |
| SMILES | CCc1csc([C@H](Cc2ccc(NS(=O)O)cc2)NC(=O)CC2=CCC(F)C(F)=C2)n1 |
| InChI | InChI=1S/C21H23F2N3O3S2/c1-2-15-12-30-21(24-15)19(10-13-3-6-16(7-4-13)26-31(28)29)25-20(27)11-14-5-8-17(22)18(23)9-14/h3-7,9,12,17,19,26H,2,8,10-11H2,1H3,(H,25,27)(H,28,29)/t17?,19-/m0/s1 |
| InChIKey | AJJVONPVNBYBPT-NNBQYGFHSA-N |
| XLogP | 4.57 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.56 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|