C26H32N4O5S2 — CID 24815875
[4-[(2S)-2-[[(2S)-2-acetamido-3-phenylpropanoyl]amino]-2-(4-tert-butyl-1,3-thiazol-2-yl)ethyl]phenyl]sulfamic acid (PubChem CID 24815875) has the molecular formula C26H32N4O5S2 and a molecular weight of 544.70 g/mol. Its IUPAC name is [4-[(2S)-2-[[(2S)-2-acetamido-3-phenylpropanoyl]amino]-2-(4-tert-butyl-1,3-thiazol-2-yl)ethyl]phenyl]sulfamic acid.
| Compound Name | [4-[(2S)-2-[[(2S)-2-acetamido-3-phenylpropanoyl]amino]-2-(4-tert-butyl-1,3-thiazol-2-yl)ethyl]phenyl]sulfamic acid |
|---|---|
| PubChem CID | 24815875 |
| Molecular Formula | C26H32N4O5S2 |
| Molecular Weight | 544.70 g/mol |
| Exact Mass | 544.18 |
| IUPAC Name | [4-[(2S)-2-[[(2S)-2-acetamido-3-phenylpropanoyl]amino]-2-(4-tert-butyl-1,3-thiazol-2-yl)ethyl]phenyl]sulfamic acid |
| SMILES | CC(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccc(NS(=O)(=O)O)cc1)c1nc(C(C)(C)C)cs1 |
| InChI | InChI=1S/C26H32N4O5S2/c1-17(31)27-21(14-18-8-6-5-7-9-18)24(32)28-22(25-29-23(16-36-25)26(2,3)4)15-19-10-12-20(13-11-19)30-37(33,34)35/h5-13,16,21-22,30H,14-15H2,1-4H3,(H,27,31)(H,28,32)(H,33,34,35)/t21-,22-/m0/s1 |
| InChIKey | RGULHINSXZCWCM-VXKWHMMOSA-N |
| XLogP | 3.80 |
| TPSA | 137.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.70 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|