C25H30N4O6S — CID 139445192
[4-[2-(2-ethyl-3H-pyrrol-5-yl)-2-[[2-(methoxycarbonylamino)-3-phenylpropanoyl]amino]ethyl]phenyl]sulfamic acid (PubChem CID 139445192) has the molecular formula C25H30N4O6S and a molecular weight of 514.60 g/mol. Its IUPAC name is [4-[2-(2-ethyl-3H-pyrrol-5-yl)-2-[[2-(methoxycarbonylamino)-3-phenylpropanoyl]amino]ethyl]phenyl]sulfamic acid.
| Compound Name | [4-[2-(2-ethyl-3H-pyrrol-5-yl)-2-[[2-(methoxycarbonylamino)-3-phenylpropanoyl]amino]ethyl]phenyl]sulfamic acid |
|---|---|
| PubChem CID | 139445192 |
| Molecular Formula | C25H30N4O6S |
| Molecular Weight | 514.60 g/mol |
| Exact Mass | 514.19 |
| IUPAC Name | [4-[2-(2-ethyl-3H-pyrrol-5-yl)-2-[[2-(methoxycarbonylamino)-3-phenylpropanoyl]amino]ethyl]phenyl]sulfamic acid |
| SMILES | CCC1=NC(C(Cc2ccc(NS(=O)(=O)O)cc2)NC(=O)C(Cc2ccccc2)NC(=O)OC)=CC1 |
| InChI | InChI=1S/C25H30N4O6S/c1-3-19-13-14-21(26-19)22(15-18-9-11-20(12-10-18)29-36(32,33)34)27-24(30)23(28-25(31)35-2)16-17-7-5-4-6-8-17/h4-12,14,22-23,29H,3,13,15-16H2,1-2H3,(H,27,30)(H,28,31)(H,32,33,34) |
| InChIKey | WPZZMGXMVPTAFJ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 146.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.60 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|