C24H31N5O6S2 — CID 175855369
azane;[4-[(2S)-2-(2-ethyl-1,3-thiazol-4-yl)-2-[[2-(methoxycarbonylamino)-3-phenylpropanoyl]amino]ethyl]phenyl]sulfamic acid (PubChem CID 175855369) has the molecular formula C24H31N5O6S2 and a molecular weight of 549.68 g/mol. Its IUPAC name is azane;[4-[(2S)-2-(2-ethyl-1,3-thiazol-4-yl)-2-[[2-(methoxycarbonylamino)-3-phenylpropanoyl]amino]ethyl]phenyl]sulfamic acid.
| Compound Name | azane;[4-[(2S)-2-(2-ethyl-1,3-thiazol-4-yl)-2-[[2-(methoxycarbonylamino)-3-phenylpropanoyl]amino]ethyl]phenyl]sulfamic acid |
|---|---|
| PubChem CID | 175855369 |
| Molecular Formula | C24H31N5O6S2 |
| Molecular Weight | 549.68 g/mol |
| Exact Mass | 549.17 |
| IUPAC Name | azane;[4-[(2S)-2-(2-ethyl-1,3-thiazol-4-yl)-2-[[2-(methoxycarbonylamino)-3-phenylpropanoyl]amino]ethyl]phenyl]sulfamic acid |
| SMILES | CCc1nc([C@H](Cc2ccc(NS(=O)(=O)O)cc2)NC(=O)C(Cc2ccccc2)NC(=O)OC)cs1.N |
| InChI | InChI=1S/C24H28N4O6S2.H3N/c1-3-22-25-21(15-35-22)19(13-17-9-11-18(12-10-17)28-36(31,32)33)26-23(29)20(27-24(30)34-2)14-16-7-5-4-6-8-16;/h4-12,15,19-20,28H,3,13-14H2,1-2H3,(H,26,29)(H,27,30)(H,31,32,33);1H3/t19-,20?;/m0./s1 |
| InChIKey | PHPIESJQMXPUST-CQLADDOKSA-N |
| XLogP | 3.45 |
| TPSA | 181.72 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.68 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|