C24H28N4O6S2 — CID 24857293
[4-[(2S)-2-(2-ethyl-1,3-thiazol-4-yl)-2-[(1-methoxy-1-oxo-3-phenylpropan-2-yl)carbamoylamino]ethyl]phenyl]sulfamic acid (PubChem CID 24857293) has the molecular formula C24H28N4O6S2 and a molecular weight of 532.64 g/mol. Its IUPAC name is [4-[(2S)-2-(2-ethyl-1,3-thiazol-4-yl)-2-[(1-methoxy-1-oxo-3-phenylpropan-2-yl)carbamoylamino]ethyl]phenyl]sulfamic acid.
| Compound Name | [4-[(2S)-2-(2-ethyl-1,3-thiazol-4-yl)-2-[(1-methoxy-1-oxo-3-phenylpropan-2-yl)carbamoylamino]ethyl]phenyl]sulfamic acid |
|---|---|
| PubChem CID | 24857293 |
| Molecular Formula | C24H28N4O6S2 |
| Molecular Weight | 532.64 g/mol |
| Exact Mass | 532.15 |
| IUPAC Name | [4-[(2S)-2-(2-ethyl-1,3-thiazol-4-yl)-2-[(1-methoxy-1-oxo-3-phenylpropan-2-yl)carbamoylamino]ethyl]phenyl]sulfamic acid |
| SMILES | CCc1nc([C@H](Cc2ccc(NS(=O)(=O)O)cc2)NC(=O)NC(Cc2ccccc2)C(=O)OC)cs1 |
| InChI | InChI=1S/C24H28N4O6S2/c1-3-22-25-21(15-35-22)19(13-17-9-11-18(12-10-17)28-36(31,32)33)26-24(30)27-20(23(29)34-2)14-16-7-5-4-6-8-16/h4-12,15,19-20,28H,3,13-14H2,1-2H3,(H2,26,27,30)(H,31,32,33)/t19-,20?/m0/s1 |
| InChIKey | MWQRKVACJBQQFD-XJDOXCRVSA-N |
| XLogP | 3.29 |
| TPSA | 146.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.64 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|