C26H24ClN3O6S3 — CID 59721441
[4-[(2S)-2-[[(2S)-2-benzyl-3-methoxy-3-oxopropanoyl]amino]-2-[2-(3-chlorothiophen-2-yl)-1,3-thiazol-4-yl]ethyl]phenyl]sulfamic acid (PubChem CID 59721441) has the molecular formula C26H24ClN3O6S3 and a molecular weight of 606.15 g/mol. Its IUPAC name is [4-[(2S)-2-[[(2S)-2-benzyl-3-methoxy-3-oxopropanoyl]amino]-2-[2-(3-chlorothiophen-2-yl)-1,3-thiazol-4-yl]ethyl]phenyl]sulfamic acid.
| Compound Name | [4-[(2S)-2-[[(2S)-2-benzyl-3-methoxy-3-oxopropanoyl]amino]-2-[2-(3-chlorothiophen-2-yl)-1,3-thiazol-4-yl]ethyl]phenyl]sulfamic acid |
|---|---|
| PubChem CID | 59721441 |
| Molecular Formula | C26H24ClN3O6S3 |
| Molecular Weight | 606.15 g/mol |
| Exact Mass | 605.05 |
| IUPAC Name | [4-[(2S)-2-[[(2S)-2-benzyl-3-methoxy-3-oxopropanoyl]amino]-2-[2-(3-chlorothiophen-2-yl)-1,3-thiazol-4-yl]ethyl]phenyl]sulfamic acid |
| SMILES | COC(=O)[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccc(NS(=O)(=O)O)cc1)c1csc(-c2sccc2Cl)n1 |
| InChI | InChI=1S/C26H24ClN3O6S3/c1-36-26(32)19(13-16-5-3-2-4-6-16)24(31)28-21(14-17-7-9-18(10-8-17)30-39(33,34)35)22-15-38-25(29-22)23-20(27)11-12-37-23/h2-12,15,19,21,30H,13-14H2,1H3,(H,28,31)(H,33,34,35)/t19-,21-/m0/s1 |
| InChIKey | BELXMYIGRMJSNJ-FPOVZHCZSA-N |
| XLogP | 5.17 |
| TPSA | 134.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.15 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|