C20H26N4O6S2 — CID 70332785
[4-[(2S)-2-(2-cyclopropyl-1,3-thiazol-4-yl)-2-[[(2S)-2-(methoxycarbonylamino)butanoyl]amino]ethyl]phenyl]sulfamic acid (PubChem CID 70332785) has the molecular formula C20H26N4O6S2 and a molecular weight of 482.58 g/mol. Its IUPAC name is [4-[(2S)-2-(2-cyclopropyl-1,3-thiazol-4-yl)-2-[[(2S)-2-(methoxycarbonylamino)butanoyl]amino]ethyl]phenyl]sulfamic acid.
| Compound Name | [4-[(2S)-2-(2-cyclopropyl-1,3-thiazol-4-yl)-2-[[(2S)-2-(methoxycarbonylamino)butanoyl]amino]ethyl]phenyl]sulfamic acid |
|---|---|
| PubChem CID | 70332785 |
| Molecular Formula | C20H26N4O6S2 |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.13 |
| IUPAC Name | [4-[(2S)-2-(2-cyclopropyl-1,3-thiazol-4-yl)-2-[[(2S)-2-(methoxycarbonylamino)butanoyl]amino]ethyl]phenyl]sulfamic acid |
| SMILES | CC[C@H](NC(=O)OC)C(=O)N[C@@H](Cc1ccc(NS(=O)(=O)O)cc1)c1csc(C2CC2)n1 |
| InChI | InChI=1S/C20H26N4O6S2/c1-3-15(23-20(26)30-2)18(25)21-16(17-11-31-19(22-17)13-6-7-13)10-12-4-8-14(9-5-12)24-32(27,28)29/h4-5,8-9,11,13,15-16,24H,3,6-7,10H2,1-2H3,(H,21,25)(H,23,26)(H,27,28,29)/t15-,16-/m0/s1 |
| InChIKey | AVUAHBJMESLAHR-HOTGVXAUSA-N |
| XLogP | 2.77 |
| TPSA | 146.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|